ChemNet > CAS > 824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid
824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid
Naam product |
Bicyclo[2.2.1]heptane-2-carboxylic Acid |
Engelse naam |
Bicyclo[2.2.1]heptane-2-carboxylic Acid; Norbornane-2-carboxylic acid; (1R,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate; (1S,2S,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
MF |
C8H11O2 |
Molecuulgewicht |
139.1723 |
InChI |
InChI=1/C8H12O2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,9,10)/p-1/t5-,6+,7+/m1/s1 |
CAS-nummer |
824-62-4 |
EINECS |
212-532-2 |
Moleculaire Structuur |
|
Kookpunt |
247.822°C at 760 mmHg |
Vlampunt |
113.81°C |
Dampdruk |
0.008mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|